For research use only. Not for therapeutic Use.
Ethyl cyclohexanepropionate is an ester compound with a cyclohexane ring and a propionate chain, commonly used in fragrance, flavoring, and organic synthesis. Its pleasant odor makes it valuable in formulating fragrances and flavors for consumer products. In synthetic chemistry, it serves as an intermediate for creating more complex molecules, particularly for pharmaceutical and agrochemical applications. The ester functionality enables diverse chemical transformations, making it a versatile compound for developing specialty chemicals and bioactive compounds in various research fields.
CAS Number | 10094-36-7 |
Molecular Formula | C11H20O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 3-cyclohexylpropanoate |
InChI | InChI=1S/C11H20O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h10H,2-9H2,1H3 |
InChIKey | NRVPMFHPHGBQLP-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCC1CCCCC1 |