For research use only. Not for therapeutic Use.
Ethyl D-glucopyranoside(CAT: L036313) is a high-purity carbohydrate derivative featuring a glucopyranose structure with an ethyl glycosidic linkage. This compound is widely used in biochemical and pharmaceutical research, particularly in the study of carbohydrate metabolism, glycosylation processes, and as a precursor in the synthesis of glycosides. Its stable structure and consistent quality make it an essential reagent for exploring molecular interactions and designing bioactive compounds. Ethyl D-glucopyranoside is also valuable in developing functional materials and as a model compound in carbohydrate chemistry, supporting innovative advancements in research and development.
CAS Number | 34625-23-5 |
Molecular Formula | C8H16O6 |
Purity | ≥95% |
IUPAC Name | (3R,4S,5S,6R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
InChI | InChI=1S/C8H16O6/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8/h4-12H,2-3H2,1H3/t4-,5-,6+,7-,8?/m1/s1 |
InChIKey | WYUFTYLVLQZQNH-KEWYIRBNSA-N |
SMILES | CCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |