For research use only. Not for therapeutic Use.
Ethyl-d5-amine is a deuterated form of ethylamine, where five hydrogen atoms have been replaced with deuterium atoms. This compound is particularly valuable for research applications in areas such as organic synthesis, metabolic studies, and isotope-dilution mass spectrometry. The deuterium labeling enhances the stability of the molecule and allows for precise tracking in complex biological and chemical systems. Ethyl-d5-amine is often used as an internal standard in analytical chemistry, providing accurate and reproducible results in the quantification of amine-containing compounds. It is also useful in studying the behavior and reactivity of ethylamine derivatives in various chemical reactions, making it a crucial tool in pharmaceutical research, material science, and related fields.
CAS Number | 17616-24-9 |
Molecular Formula | C2H7N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1,2,2,2-pentadeuterioethanamine |
InChI | InChI=1S/C2H7N/c1-2-3/h2-3H2,1H3/i1D3,2D2 |
InChIKey | QUSNBJAOOMFDIB-ZBJDZAJPSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |