For research use only. Not for therapeutic Use.
Ethyl (E)-2-hexenoate consists of a six-carbon chain with a double bond between the 2nd and 3rd carbon atoms, an ethyl ester group attached to the 1st carbon atom, and a A methyl group connected by 4 carbon atoms. This compound has a fruity, sweet or floral aroma and is commonly used as a flavoring in foods such as baked goods, confectionary and beverages.
Ethyl (E)-2-hexenoate is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Catalog Number | R062833 |
| CAS Number | 27829-72-7 |
| Synonyms | ethyl (E)-hex-2-enoate |
| Molecular Formula | C8H14O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h6-7H,3-5H2,1-2H3/b7-6+ |
| InChIKey | SJRXWMQZUAOMRJ-VOTSOKGWSA-N |
| SMILES | CCCC=CC(=O)OCC |
