For research use only. Not for therapeutic Use.
Ethyl (E)-3-(2,3-dichlorophenyl)acrylate(CAT: L000328)is a significant compound in the fields of organic chemistry and material chemistry. This chemical serves as a valuable intermediate for the synthesis of organic molecules, particularly those used in the production of functional materials. Its primary application is in the modification of organic compounds to introduce specific properties, such as enhanced electronic or optical characteristics.
CAS Number | 154238-78-5 |
Molecular Formula | C11H10Cl2O2 |
Purity | ≥95% |
IUPAC Name | ethyl (E)-3-(2,3-dichlorophenyl)prop-2-enoate |
InChI | InChI=1S/C11H10Cl2O2/c1-2-15-10(14)7-6-8-4-3-5-9(12)11(8)13/h3-7H,2H2,1H3/b7-6+ |
InChIKey | SVYCGHOTVMOUMC-VOTSOKGWSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |