For research use only. Not for therapeutic Use.
Ethyl fluoroacetate (Cat.No:I027098) is a highly toxic compound used in various applications, including as a pesticide and chemical intermediate. It is a colorless liquid that, when ingested or inhaled, can cause severe poisoning and even death. Due to its high toxicity, strict precautions and handling procedures must be followed to ensure safety.
| Catalog Number | I027098 |
| CAS Number | 459-72-3 |
| Synonyms | Ethyl fluoroacetate |
| Molecular Formula | C4H7FO2 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | ethyl 2-fluoroacetate |
| InChI | InChI=1S/C4H7FO2/c1-2-7-4(6)3-5/h2-3H2,1H3 |
| InChIKey | VCYZVXRKYPKDQB-UHFFFAOYSA-N |
| SMILES | O=C(OCC)CF |
