For research use only. Not for therapeutic Use.
Ethyl Isocyanoacetate (Cat.No:R022459) is a versatile chemical compound used in organic synthesis. It serves as a valuable building block in the preparation of various heterocyclic and complex molecules. Its isocyano group imparts unique reactivity, making it valuable in pharmaceutical and agrochemical research for the development of new compounds with diverse properties.
CAS Number | 2999-46-4 |
Synonyms | 2-Isocyanoacetic Acid Ethyl Ester; (Ethoxycarbonyl)methyl Isonitrile; 2-Ethoxy-2-oxoethyl Isocyanide; Ethoxycarbonylmethyl Isocyanide; Ethyl α-Isocyanoacetate; Isocyanoacetic Acid Ethyl Ester; α-Isocyanoacetic Acid Ethyl Ester; |
Molecular Formula | C5H7NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 2-isocyanoacetate |
InChI | InChI=1S/C5H7NO2/c1-3-8-5(7)4-6-2/h3-4H2,1H3 |
InChIKey | FPULFENIJDPZBX-UHFFFAOYSA-N |
SMILES | CCOC(=O)C[N+]#[C-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |