For research use only, not for therapeutic use.
Ethyl Maltol-d5（Cat No.:S001135） is a deuterated form of Ethyl Maltol, where five hydrogen atoms are replaced with deuterium. This isotopic enhancement significantly improves its stability and makes it highly useful for analytical studies in food chemistry and fragrance research. Ethyl Maltol-d5 is instrumental in studying the behavior and stability of flavor compounds under various conditions, aiding in the development of more effective flavoring agents and preservatives. Its application in sensory analysis and product development allows for precise quantification and understanding of flavor interactions, enhancing product quality and consumer satisfaction.
| Catalog Number | S001135 |
| Molecular Formula | C8H5D5O3 |
| Purity | ≥95% |
| IUPAC Name | 3-hydroxy-2-(2,2,3,3,3-pentadeuteriopropyl)pyran-4-one |
| InChI | InChI=1S/C8H10O3/c1-2-3-7-8(10)6(9)4-5-11-7/h4-5,10H,2-3H2,1H3/i1D3,2D2 |
| InChIKey | DWAFWTJANIITML-ZBJDZAJPSA-N |
| SMILES | CCCC1=C(C(=O)C=CO1)O |
