For research use only. Not for therapeutic Use.
Ethyl morpholine-2-carboxylate(Cat No.:M004499)is an organic compound featuring a morpholine ring with an ethyl ester group attached to the 2-position. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, offering versatility in chemical modifications. The morpholine ring imparts stability and unique reactivity, making it valuable in medicinal chemistry for the development of bioactive molecules. Ethyl morpholine-2-carboxylate is essential for researchers and chemists working on the synthesis of complex organic compounds, particularly in drug discovery and development.
CAS Number | 107904-06-3 |
Molecular Formula | C7H13NO3 |
Purity | ≥95% |
IUPAC Name | ethyl morpholine-2-carboxylate |
InChI | InChI=1S/C7H13NO3/c1-2-10-7(9)6-5-8-3-4-11-6/h6,8H,2-5H2,1H3 |
InChIKey | PTWKMUDNOPBYJO-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1CNCCO1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |