For research use only. Not for therapeutic Use.
Ethyl octanoate-d15(Cat No.:S000776) is a deuterium-labeled version of ethyl octanoate, an ester commonly found in various fruits and responsible for their pleasant aromas. This compound, with the chemical formula C10H5D15O2, features fifteen deuterium atoms replacing most of the hydrogen atoms in the ethyl octanoate structure. It is widely used in analytical chemistry for tracing and studying the ester’s behavior in complex biological or chemical systems. Its application in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy allows for precise, detailed analysis of metabolic pathways and interaction mechanisms.
CAS Number | 1219798-38-5 |
Molecular Formula | C10H5D15O2 |
Purity | ≥95% |
IUPAC Name | ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate |
InChI | InChI=1S/C10H20O2/c1-3-5-6-7-8-9-10(11)12-4-2/h3-9H2,1-2H3/i1D3,3D2,5D2,6D2,7D2,8D2,9D2 |
InChIKey | YYZUSRORWSJGET-MVIIYOROSA-N |
SMILES | CCCCCCCC(=O)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |