For research use only. Not for therapeutic Use.
Ethyl oxanilate is an organic ester with the formula C9H11NO2. It consists of an oxanilic acid (a derivative of anthranilic acid) where the carboxyl group (-COOH) is esterified with an ethyl group (-CH2CH3), forming an ethyl ester. This compound is typically used in organic synthesis as a building block for more complex molecules. It may have applications in the production of pharmaceuticals, agrochemicals, or as a starting material for the synthesis of other functionalized organic compounds.
CAS Number | 1457-85-8 |
Molecular Formula | C10H11NO3 |
Purity | ≥95% |
Storage | Desiccate at +4 ℃ |
IUPAC Name | ethyl 2-anilino-2-oxoacetate |
InChI | InChI=1S/C10H11NO3/c1-2-14-10(13)9(12)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,11,12) |
InChIKey | YDGAUBHNAKCSKF-UHFFFAOYSA-N |
SMILES | CCOC(=O)C(=O)NC1=CC=CC=C1 |