For research use only. Not for therapeutic Use.
Ethyl perfluoro isobutyl ether(Cat No.:M037972), also known as perfluoroalkyl isobutyl ether, is a fluorinated ether characterized by its exceptional chemical and thermal stability due to the presence of fluorine atoms replacing all hydrogen atoms. This modification results in a molecule with unique properties such as low viscosity, high gas solubility, and excellent dielectric characteristics. It is primarily used as a specialty solvent in the chemical and electronics industries for applications that require inert conditions. Additionally, its properties make it useful in applications such as refrigeration and as a heat transfer fluid in demanding environments.
CAS Number | 163702-06-5 |
Synonyms | 2-(Ethoxydifluoromethyl)-1,1,1,2,3,3,3-heptafluoropropane; Ethyl perfluoroisobutyl ether |
Molecular Formula | C6H5F9O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane |
InChI | InChI=1S/C6H5F9O/c1-2-16-6(14,15)3(7,4(8,9)10)5(11,12)13/h2H2,1H3 |
InChIKey | SQEGLLMNIBLLNQ-UHFFFAOYSA-N |
SMILES | CCOC(C(C(F)(F)F)(C(F)(F)F)F)(F)F |