For research use only. Not for therapeutic Use.
Ethyl Pyrimidine-4-carboxylate(Cat No.:L024116)is an important intermediate in pharmaceutical and chemical research, primarily used in the synthesis of heterocyclic compounds. This ester derivative of pyrimidine is a valuable building block for developing a wide range of bioactive molecules, including antiviral, anticancer, and anti-inflammatory agents. Its unique structure, featuring a pyrimidine ring and ester group, allows for versatile chemical transformations, making it essential in medicinal chemistry and drug discovery. With high purity and consistent quality, Ethyl Pyrimidine-4-carboxylate supports precise synthetic reactions and reliable outcomes in advanced research projects.
CAS Number | 62846-82-6 |
Molecular Formula | C7H8N2O2 |
Purity | ≥95% |
IUPAC Name | ethyl pyrimidine-4-carboxylate |
InChI | InChI=1S/C7H8N2O2/c1-2-11-7(10)6-3-4-8-5-9-6/h3-5H,2H2,1H3 |
InChIKey | DWRWSNAREGLUHZ-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=NC=NC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |