For research use only. Not for therapeutic Use.
Ethyl pyrrolo[1,2-c]pyrimidine-3-carboxylate(CAT: M010526) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a fused pyrrolo-pyrimidine core with an ethyl ester group at the 3-position, it serves as a versatile building block for synthesizing bioactive molecules, including drug candidates and enzyme inhibitors. Its unique structure facilitates diverse chemical transformations, such as esterification, amidation, and coupling reactions, enabling the development of novel derivatives. With consistent reactivity and performance, Ethyl pyrrolo[1,2-c]pyrimidine-3-carboxylate is a valuable resource for advancing medicinal chemistry and organic synthesis innovations.
CAS Number | 107407-80-7 |
Molecular Formula | C10H10N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl pyrrolo[1,2-c]pyrimidine-3-carboxylate |
InChI | InChI=1S/C10H10N2O2/c1-2-14-10(13)9-6-8-4-3-5-12(8)7-11-9/h3-7H,2H2,1H3 |
InChIKey | RUBOVOPFBPEEJU-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC2=CC=CN2C=N1 |