For research use only. Not for therapeutic Use.
Ethyl trans-β-Methylcinnamate is an aromatic compound characterized by a trans double bond and an ethyl ester functional group. This compound is notable for its pleasant floral aroma, making it a valuable ingredient in the fragrance and flavor industries. Additionally, it possesses potential biological activities, including anti-inflammatory and antioxidant properties, which have drawn interest in pharmacological research. Its structural features allow for various synthetic modifications, making it a versatile building block in organic synthesis and the development of bioactive compounds.
CAS Number | 1504-72-9 |
Synonyms | (2E)-3-Phenyl-2-butenoic Acid Ethyl Ester; Ethyl (E)-3-Phenyl-2-butenoate; Ethyl trans-3-Phenylcrotonate; |
Molecular Formula | C12H14O2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | ethyl (E)-3-phenylbut-2-enoate |
InChI | InChI=1S/C12H14O2/c1-3-14-12(13)9-10(2)11-7-5-4-6-8-11/h4-9H,3H2,1-2H3/b10-9+ |
InChIKey | BSXHSWOMMFBMLL-MDZDMXLPSA-N |
SMILES | CCOC(=O)C=C(C)C1=CC=CC=C1 |