For research use only. Not for therapeutic Use.
Ethyl trans-3-Methyl-4-oxocrotonate is an organic compound commonly used as an intermediate in the synthesis of pharmaceuticals and fine chemicals. It features an ester functional group and a conjugated ketone system, making it a versatile building block for chemical reactions, including aldol condensations and Michael additions. Its structural properties allow for the formation of complex molecular frameworks, often used in the production of active pharmaceutical ingredients (APIs) or agrochemicals. Ethyl trans-3-Methyl-4-oxocrotonate is valuable in medicinal chemistry for constructing compounds with potential therapeutic activity, particularly in drug discovery and development processes.
CAS Number | 62054-49-3 |
Synonyms | (E)-3-Methyl-4-oxo-2-butenoic Acid Ethyl Ester; 3-Methyl-fumaraldehydic Acid Ethyl Ester; Ethyl (2E)-3-Methyl-4-oxobut-2-enoate |
Molecular Formula | C7H10O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl (E)-3-methyl-4-oxobut-2-enoate |
InChI | InChI=1S/C7H10O3/c1-3-10-7(9)4-6(2)5-8/h4-5H,3H2,1-2H3/b6-4+ |
InChIKey | YLFXEUMFBVGYEL-GQCTYLIASA-N |
SMILES | CCOC(=O)C=C(C)C=O |