For research use only. Not for therapeutic Use.
Ethyldichlorophosphine（Cat No.:M048659）, is a chemical compound with versatile applications in the field of organic synthesis. It contains two chlorine atoms attached to a phosphorus atom and an ethyl group. This compound is utilized as a valuable reagent in organic chemistry, particularly in the creation of various organophosphorus compounds. It plays a pivotal role in the synthesis of phosphine ligands used in catalysis and is employed to introduce phosphine functionality into molecules. Ethyldichlorophosphine’s reactivity and compatibility with other reagents make it a crucial tool for chemists in the development of pharmaceuticals, agrochemicals, and materials science research.
| Catalog Number | M048659 |
| CAS Number | 1498-40-4 |
| Molecular Formula | C2H5Cl2P |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | dichloro(ethyl)phosphane |
| InChI | InChI=1S/C2H5Cl2P/c1-2-5(3)4/h2H2,1H3 |
| InChIKey | JHNJGLVSPIMBLD-UHFFFAOYSA-N |
| SMILES | CCP(Cl)Cl |
