For research use only. Not for therapeutic Use.
Ethylene-d4 Glycol (CAT:R041511) is a deuterated derivative of ethylene glycol, a widely used chemical compound. It is labeled with deuterium atoms, making it valuable in various applications, particularly in NMR spectroscopy for studying molecular structures. This isotopically labeled compound aids in precise analysis and characterization of organic compounds.
| Catalog Number | R041511 |
| CAS Number | 2219-51-4 |
| Synonyms | 1,2-Ethane-1,1,2,2-d4-diol; 1,2-Ethane-d4-diol |
| Molecular Formula | C2H6O2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Store at -20C |
| IUPAC Name | 1,1,2,2-tetradeuterioethane-1,2-diol |
| InChI | InChI=1S/C2H6O2/c3-1-2-4/h3-4H,1-2H2/i1D2,2D2 |
| InChIKey | LYCAIKOWRPUZTN-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)O |
