Ethylene glycol dimethacrylate (EGDMA) is a bifunctional monomer widely used in the production of crosslinked polymers, particularly in the synthesis of dental materials, adhesives, and coatings. It possesses two methacrylate groups linked by an ethylene glycol spacer, allowing for polymerization reactions that create strong, durable networks. EGDMA enhances mechanical properties and chemical resistance in various applications, contributing to the versatility and performance of polymer-based materials.
| Catalog Number | R070593 |
| CAS Number | 97-90-5 |
| Synonyms | inhibited with Hydroquinone monomethyl ether |
| Molecular Formula | C10H14O4 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
| InChI | InChI=1S/C10H14O4/c1-7(2)9(11)13-5-6-14-10(12)8(3)4/h1,3,5-6H2,2,4H3 |
| InChIKey | STVZJERGLQHEKB-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOC(=O)C(=C)C |
