For research use only. Not for therapeutic Use.
Ethylene Glycol Distearate (Cat.No:M006875) is a fatty acid ester commonly used in personal care products like shampoos and conditioners. It serves as an opacifying agent, giving these products a pearly or creamy appearance. Additionally, it functions as an emollient, providing moisturizing and skin-conditioning properties.
Catalog Number | M006875 |
CAS Number | 627-83-8 |
Synonyms | Alkamuls EGDS;EGDS;Elfan L 310;Emerest 2355;Ethylene glycol dioctadecanoate;Ethylene glycol distearate VA;Ethylene stearate;ethyleneglycoldlstearate |
Molecular Formula | C38H74O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-octadecanoyloxyethyl octadecanoate |
InChI | InChI=1S/C38H74O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(39)41-35-36-42-38(40)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-36H2,1-2H3 |
InChIKey | FPVVYTCTZKCSOJ-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCOC(=O)CCCCCCCCCCCCCCCCC |