For research use only. Not for therapeutic Use.
Ethylene terephthalate cyclic hexamer (Cat No.:C000786) is a chemical compound comprising a cyclic arrangement of six repeating units of ethylene terephthalate. This compound is of interest in polymer chemistry and materials science. Its cyclic structure has potential applications in understanding polymerization processes, material properties, and behavior. Researchers likely investigate its reactivity, stability, and potential for depolymerization. Studies into its properties could advance polymer synthesis, processing techniques, and material recycling. Insights into the structural characteristics and behaviors of ethylene terephthalate-based polymers, commonly found in plastics and fibers, contribute to advancements in industrial applications and sustainable materials.
| Catalog Number | C000786 |
| CAS Number | 29644-29-9 |
| Synonyms | 3,6,13,16,23,26,33,36,43,46,53,56-Dodecaoxaheptacyclo[56.2.2.28,11.218,21.228,31.238,41.248,51]doheptaconta-8,10,18,20,28,30,38,40,48,50,58,60,61,63,65,67,69,71-octadecaene-2,7,12,17,22,27,32,37,42,47,52,57-dodecone; Terephthalic Acid, Hexamol. Cyclic Ethylene Ester; Ethylene Glycol, Hexamol. Cyclic Terephthalate |
| Molecular Formula | C₆₀H₄₈O₂₄ |
| Purity | ≥95% |
| Solubility | Chloroform (Very Slightly, Partially Soluble), Nitrobenzene (Very Slightly, Heat |
| Appearance | White to Off-White Solid |
| Storage | 4°C |
| IUPAC Name | 3,6,13,16,23,26,33,36,43,46,53,56-dodecaoxaheptacyclo[56.2.2.28,11.218,21.228,31.238,41.248,51]doheptaconta-1(61),8,10,18,20,28,30,38(66),39,41(65),48(64),49,51(63),58(62),59,67,69,71-octadecaene-2,7,12,17,22,27,32,37,42,47,52,57-dodecone |
| InChI | InChI=1S/C60H48O24/c61-49-37-1-2-38(4-3-37)50(62)74-27-28-76-52(64)40-9-11-42(12-10-40)54(66)78-31-32-80-56(68)44-17-19-46(20-18-44)58(70)82-35-36-84-60(72)48-23-21-47(22-24-48)59(71)83-34-33-81-57(69)45-15-13-43(14-16-45)55(67)79-30-29-77-53(65)41-7-5-39(6-8-41)51(63)75-26-25-73-49/h1-24H,25-36H2 |
| InChIKey | LIXRDKDLRMBFRK-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=CC=C(C=C2)C(=O)OCCOC(=O)C3=CC=C(C=C3)C(=O)OCCOC(=O)C4=CC=C(C=C4)C(=O)OCCOC(=O)C5=CC=C(C=C5)C(=O)OCCOC(=O)C6=CC=C(C=C6)C(=O)OCCOC(=O)C7=CC=C(C=C7)C(=O)O1 |
| Reference | Castle, L., et al.: Food Addit. Contam., 7, 779 (1990) |
