For research use only. Not for therapeutic Use.
Ethylene terephthalate cyclic pentamer (Cat No.:C000787) is a chemical compound composed of five repeating units of ethylene terephthalate arranged in a cyclic structure. This compound likely holds significance in polymer chemistry and materials science. Its cyclic arrangement suggests potential applications in understanding polymerization, material properties, and behavior. Researchers may study its reactivity, stability, and potential for depolymerization.
| Catalog Number | C000787 |
| CAS Number | 16104-97-5 |
| Synonyms | 3,6,13,16,23,26,33,36,43,46-Decaoxahexacyclo[46.2.2.28,11.218,21.228,31.238,41]hexaconta-8,10,18,20,28,30,38,40,48,50,51,53,55,57,59-pentadecaene-2,7,12,17,22,27,32,37,42,47-decone; Terephthalic Acid, Pentamol. Cyclic Ethylene Ester; Ethylene Glycol, Pentamol. Cyclic Terephthalate |
| Molecular Formula | C₅₀H₄₀O₂₀ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly, Heated) |
| Appearance | Pale Yellow to Light Yellow Solid |
| Storage | -20°C |
| IUPAC Name | 3,6,13,16,23,26,33,36,43,46-decaoxahexacyclo[46.2.2.28,11.218,21.228,31.238,41]hexaconta-1(51),8,10,18,20,28(56),29,31(55),38(54),39,41(53),48(52),49,57,59-pentadecaene-2,7,12,17,22,27,32,37,42,47-decone |
| InChI | InChI=1S/C50H40O20/c51-41-31-1-2-32(4-3-31)42(52)62-23-24-64-44(54)34-9-11-36(12-10-34)46(56)66-27-28-68-48(58)38-17-19-40(20-18-38)50(60)70-30-29-69-49(59)39-15-13-37(14-16-39)47(57)67-26-25-65-45(55)35-7-5-33(6-8-35)43(53)63-22-21-61-41/h1-20H,21-30H2 |
| InChIKey | LVWYQUGWJKUBQW-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=CC=C(C=C2)C(=O)OCCOC(=O)C3=CC=C(C=C3)C(=O)OCCOC(=O)C4=CC=C(C=C4)C(=O)OCCOC(=O)C5=CC=C(C=C5)C(=O)OCCOC(=O)C6=CC=C(C=C6)C(=O)O1 |
| Reference | Castle, L., et al.: Food Addit. Contam., 7, 779 (1990) |
