For research use only. Not for therapeutic Use.
Ethylene terephthalate cyclic tetramer (Cat No.:C000788) is a chemical compound composed of four repeating units of ethylene terephthalate in a cyclic arrangement. This compound likely holds significance in polymer chemistry and materials science. Its cyclic structure suggests potential applications in understanding polymerization processes, material properties, and polymer behavior. Researchers may study its reactivity, stability, and potential for depolymerization.
| Catalog Number | C000788 |
| CAS Number | 16104-96-4 |
| Synonyms | 3,6,13,16,23,26,33,36-Octaoxapentacyclo[36.2.2.28,11.218,21.228,31]octatetraconta-8,10,18,20,28,30,38,40,41,43,45,47-dodecaene-2,7,12,17,22,27,32,37-octone; Terephthalic Acid, Tetramol. Cyclic Ethylene Ester; 3,6,13,16,23,26,33,36-Octaoxapentacyclo[36.2.2.28,11.218,21.228,31]octatetraconta-8,10,18,20,28,30,38,40,41,43,45,47-dodecaen-2,7,12,17,22,27,32,37-octone; Ethylene Glycol, Tetramol. Cyclic Terephthalate; Ethylene Terephthalate Cyclic Tetramer |
| Molecular Formula | C₄₀H₃₂O₁₆ |
| Purity | ≥95% |
| Appearance | White to Off-White Solid |
| Storage | 4°C |
| IUPAC Name | 3,6,13,16,23,26,33,36-octaoxapentacyclo[36.2.2.28,11.218,21.228,31]octatetraconta-1(41),8,10,18,20,28(44),29,31(43),38(42),39,45,47-dodecaene-2,7,12,17,22,27,32,37-octone |
| InChI | InChI=1S/C40H32O16/c41-33-25-1-2-26(4-3-25)34(42)50-19-20-52-36(44)28-9-11-30(12-10-28)38(46)54-23-24-56-40(48)32-15-13-31(14-16-32)39(47)55-22-21-53-37(45)29-7-5-27(6-8-29)35(43)51-18-17-49-33/h1-16H,17-24H2 |
| InChIKey | WTZSFTBPHXWONC-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=CC=C(C=C2)C(=O)OCCOC(=O)C3=CC=C(C=C3)C(=O)OCCOC(=O)C4=CC=C(C=C4)C(=O)OCCOC(=O)C5=CC=C(C=C5)C(=O)O1 |
| Reference | Castle, L., et al.: Food Addit. Contam., 7, 779 (1990) |
