For research use only. Not for therapeutic Use.
Ethylenediamine-N,N,N’,N’-tetraacetic acid (EDTA) is a versatile chelating agent with the molecular formula C₁₀H₁₆N₂O₈. It contains four carboxylic acid groups and two amine groups, allowing it to form stable complexes with metal ions. EDTA is widely used in various applications, including medicine, where it helps treat heavy metal poisoning, and in analytical chemistry for metal ion detection and removal. Its ability to bind metals also makes it valuable in agriculture, cosmetics, and water treatment, highlighting its broad utility across multiple fields.
CAS Number | 60-00-4 |
Synonyms | N,N’-1,2-Ethanediylbis[N-(carboxymethyl)glycine; Celon ATH; Cheelox; EDTA; Edathamil; Edetic acid; Endrate; Ethylene-N,N’-biscarboxymethyl-N,N’-diglycine; Ethylenedinitrilotetraacetic Acid; Sequestric Acid; Sequestrol; Titriplex; Trilon BW; Trilon BX |
Molecular Formula | C10H12O8CaN2Na2·2H2O |
Purity | ≥95% |
Target | Reagents |
Solubility | Soluble in water |
Storage | Store at RT |
IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
InChI | InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
InChIKey | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |