For research use only. Not for therapeutic Use.
Ethylisopropylnitrosamine(CAT: M079119) is a chemical compound associated with organic chemistry and, more specifically, as a potentially carcinogenic compound. Its action method involves being a nitrosamine, a class of compounds known to have carcinogenic properties. Due to its carcinogenicity, it is primarily studied and used as a research tool in the investigation of cancer development and prevention.
CAS Number | 16339-04-1 |
Synonyms | Diethylamine, 1-methyl-N-nitroso-; Ethylisopropylnitrosoamine; N-ethyl-N-propan-2-ylnitrous amide |
Molecular Formula | C5H12N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-ethyl-N-propan-2-ylnitrous amide |
InChI | InChI=1S/C5H12N2O/c1-4-7(6-8)5(2)3/h5H,4H2,1-3H3 |
InChIKey | VGGZTNNNXAUZLB-UHFFFAOYSA-N |
SMILES | CCN(C(C)C)N=O |
Reference | [1]. Reuber, M.D., 1975. |