For research use only. Not for therapeutic Use.
Ethynylcytidine is a nucleoside analog featuring an ethynyl group attached to the cytidine structure. It is used in pharmaceutical research, particularly in the development of antiviral and anticancer therapies. By mimicking the natural nucleoside cytidine, ethynylcytidine is incorporated into RNA or DNA, disrupting normal cellular processes such as replication and transcription. Its unique structure makes it valuable in the design of antiviral agents, especially for treating viral infections like hepatitis or cancer, contributing to advancements in medicinal chemistry and nucleoside analog research.
CAS Number | 180300-43-0 |
Synonyms | 4-amino-1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
Molecular Formula | C11H13N3O5 |
Purity | ≥95% |
InChI | InChI=1S/C11H13N3O5/c1-2-11(18)6(5-15)19-9(8(11)16)14-4-3-7(12)13-10(14)17/h1,3-4,6,8-9,15-16,18H,5H2,(H2,12,13,17)/t6-,8+,9-,11-/m1/s1 |
InChIKey | JFIWEPHGRUDAJN-DYUFWOLASA-N |
SMILES | C#CC1(C(OC(C1O)N2C=CC(=NC2=O)N)CO)O |