For research use only. Not for therapeutic Use.
Eticlopride hydrochloride (Cat.No:I010471) is a selective dopamine D2 receptor antagonist primarily used in research settings. It is commonly employed in preclinical studies to investigate the role of dopamine receptors in various physiological and pathological processes, including neurological and psychiatric disorders. Eticlopride hydrochloride aids in understanding the mechanisms of dopamine signaling and its implications in disease development.
| Catalog Number | I010471 |
| CAS Number | 97612-24-3 |
| Synonyms | Alternative Name: (-)-Eticlopride |
| Molecular Formula | C17H25ClN2O3.HCl |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in water |
| Storage | Store at RT |
| IUPAC Name | 5-chloro-3-ethyl-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2-hydroxy-6-methoxybenzamide;hydrochloride |
| InChI | InChI=1S/C17H25ClN2O3.ClH/c1-4-11-9-13(18)16(23-3)14(15(11)21)17(22)19-10-12-7-6-8-20(12)5-2;/h9,12,21H,4-8,10H2,1-3H3,(H,19,22);1H/t12-;/m0./s1 |
| InChIKey | HFJFXXDHVWLIKX-YDALLXLXSA-N |
| SMILES | CCC1=CC(=C(C(=C1O)C(=O)NC[C@@H]2CCCN2CC)OC)Cl.Cl |
