For research use only. Not for therapeutic Use.
Etidronate is a first generation, non-nitrogenous diphosphonate analog of endogenous pyrophosphate. It binds to hydroxyapatite and induces osteoclast apoptosis, thereby inhibiting abnormal bone resorption. Unlike other bisphosphonates, etidronate may also prevent bone calcification.
| Catalog Number | R000103 |
| CAS Number | 7414-83-7 |
| Synonyms | P,P’-(1-Hydroxyethylidene)bisphosphonic Acid Sodium Salt; 1-Hydroxyethane-1,1-diphosphonic Acid Disodium Salt; BA 49280E; Calcimux; Didronel; Didronel R; Disodium (1-Hydroxyethylidene)-1,1-bisphosphonate; Disodium Ethanol-1,1-diphosphonate; Disodium |
| Molecular Formula | C2H6Na2O7P2 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | disodium;hydroxy-[1-hydroxy-1-[hydroxy(oxido)phosphoryl]ethyl]phosphinate |
| InChI | InChI=1S/C2H8O7P2.2Na/c1-2(3,10(4,5)6)11(7,8)9;;/h3H,1H3,(H2,4,5,6)(H2,7,8,9);;/q;2*+1/p-2 |
| InChIKey | GWBBVOVXJZATQQ-UHFFFAOYSA-L |
| SMILES | CC(O)(P(=O)(O)[O-])P(=O)(O)[O-].[Na+].[Na+] |
