For research use only. Not for therapeutic Use.
Etoposide(Cat No.:A001070)is a chemotherapy drug that works by inhibiting the enzyme topoisomerase II, which is essential for DNA replication and repair. By stabilizing the DNA-topoisomerase II complex, Etoposide induces DNA strand breaks, leading to cell cycle arrest and apoptosis, particularly in rapidly dividing cancer cells. It is widely used to treat various cancers, including small cell lung cancer, testicular cancer, lymphoma, and leukemia. Etoposide’s mechanism of action makes it an effective agent in combination chemotherapy regimens, contributing to its broad application in oncology treatment protocols.
CAS Number | 33419-42-0 |
Synonyms | VePesid; Toposar; Trans-Etoposide; Lastet; (-)-Etoposide |
Molecular Formula | C₂₂H₂₉FO₅ |
Purity | ≥95% |
Target | Autophagy |
Solubility | >29.4mg/mL in DMSO |
Storage | -20°C |
IUPAC Name | (5S,5aR,8aR,9R)-5-[[(2R,4aR,6R,7R,8R,8aS)-7,8-dihydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
InChI | InChI=1S/C29H32O13/c1-11-36-9-20-27(40-11)24(31)25(32)29(41-20)42-26-14-7-17-16(38-10-39-17)6-13(14)21(22-15(26)8-37-28(22)33)12-4-18(34-2)23(30)19(5-12)35-3/h4-7,11,15,20-22,24-27,29-32H,8-10H2,1-3H3/t11-,15+,20-,21-,22+,24-,25-,26-,27-,29+/m1/s1 |
InChIKey | VJJPUSNTGOMMGY-MRVIYFEKSA-N |
SMILES | C[C@@H]1OC[C@@H]2[C@@H](O1)[C@@H]([C@H]([C@@H](O2)O[C@H]3[C@H]4COC(=O)[C@@H]4[C@@H](C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)O)OC)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |