For research use only. Not for therapeutic Use.
Etretinate(Cat No.:A000004) is a synthetic retinoid, specifically developed for treating severe psoriasis and other skin disorders that do not respond well to other treatments. As a third-generation retinoid, etretinate is known for its ability to regulate cell growth and differentiation, which is particularly effective in managing skin cell production in psoriasis patients. However, due to its high teratogenic potential and the long duration it remains in the body, its use is highly regulated and generally limited to cases where other treatments have failed. Etretinate has been largely replaced by acitretin, a metabolite with a shorter half-life.
CAS Number | 54350-48-0 |
Synonyms | Tegison, Ethyl etrinoate, Retinoid, Etretinato |
Molecular Formula | C23H30O3 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | ethyl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
InChI | InChI=1S/C23H30O3/c1-8-26-23(24)14-17(3)11-9-10-16(2)12-13-21-18(4)15-22(25-7)20(6)19(21)5/h9-15H,8H2,1-7H3/b11-9+,13-12+,16-10+,17-14+ |
InChIKey | HQMNCQVAMBCHCO-DJRRULDNSA-N |
SMILES | CCOC(=O)C=C(C)C=CC=C(C)C=CC1=C(C(=C(C=C1C)OC)C)C |