For research use only. Not for therapeutic Use.
ETYA (CAT: M047487), ethyl 2-(3,5-di-tert-butyl-4-hydroxyphenyl)acetate, boasts notable antioxidant prowess. Derived from 3,5-di-tert-butyl-4-hydroxyphenylacetic acid, it safeguards cells and biomolecules from oxidative harm. ETYA’s antioxidative potency proves crucial amid oxidative stress, relevant in diverse ailments like cardiovascular and neurodegenerative disorders. By neutralizing radicals and impeding oxidation, it holds potential in ameliorating cellular destruction and disease progression.
| Catalog Number | M047487 |
| CAS Number | 1191-85-1 |
| Synonyms | 5,8,11,14-eicosatetraynoic acid |
| Molecular Formula | C20H24O2 |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | icosa-5,8,11,14-tetraynoic acid |
| InChI | InChI=1S/C20H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-5,8,11,14,17-19H2,1H3,(H,21,22) |
| InChIKey | MGLDCXPLYOWQRP-UHFFFAOYSA-N |
| SMILES | CCCCCC#CCC#CCC#CCC#CCCCC(=O)O |
