For research use only. Not for therapeutic Use.
ETZ (C3-CA-DTZ) is a promising luciferase substrate (prosubstrate) activatable in vivo by nonspecific esterase to enhance the brain delivery of the luciferin[1].
| Catalog Number | I044019 |
| CAS Number | 2989379-61-3 |
| Synonyms | 2-[4-[[4-(2-benzyl-6,8-diphenylimidazo[1,2-a]pyrazin-3-yl)oxy-4-oxobutanoyl]oxymethyl]triazol-1-yl]acetic acid |
| Molecular Formula | C34H28N6O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C34H28N6O6/c41-29(42)21-39-19-26(37-38-39)22-45-30(43)16-17-31(44)46-34-27(18-23-10-4-1-5-11-23)36-33-32(25-14-8-3-9-15-25)35-28(20-40(33)34)24-12-6-2-7-13-24/h1-15,19-20H,16-18,21-22H2,(H,41,42) |
| InChIKey | IDKRPNFSPHTVBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(N3C=C(N=C(C3=N2)C4=CC=CC=C4)C5=CC=CC=C5)OC(=O)CCC(=O)OCC6=CN(N=N6)CC(=O)O |
| Reference | [1]. Xiaodong Tian, et al. A luciferase prosubstrate and a red bioluminescent calcium indicator to image neuronal activity. bioRxiv 2021.12.06.471018. |
