For research use only. Not for therapeutic Use.
Eugenyl benzoate(Cat No.:M164796)is an ester derived from eugenol and benzoic acid, widely used in pharmaceutical research, cosmetics, and as a flavoring agent. This compound combines the soothing and aromatic properties of eugenol with the preservative qualities of benzoic acid. Its unique structure offers potential antimicrobial, antifungal, and anti-inflammatory activities, making it valuable in developing bioactive formulations. Additionally, eugenyl benzoate is utilized in fragrance and flavor industries due to its pleasant scent and stability. High purity ensures consistent performance in various applications.
CAS Number | 531-26-0 |
Molecular Formula | C17H16O3 |
Purity | ≥95% |
Target | Phenylpropanoids |
IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) benzoate |
InChI | InChI=1S/C17H16O3/c1-3-7-13-10-11-15(16(12-13)19-2)20-17(18)14-8-5-4-6-9-14/h3-6,8-12H,1,7H2,2H3 |
InChIKey | ZOGNBLKDKPCKGB-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)CC=C)OC(=O)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |