For research use only. Not for therapeutic Use.
Eugenyl glucoside(Cat No.:M086341) is a naturally derived compound formed by the combination of eugenol, a primary component of clove oil, and glucose. This glycosidic linkage involves attaching a glucose molecule to the eugenol structure, enhancing its water solubility while retaining the characteristic aroma and properties of eugenol. Eugenyl glucoside is often used in the flavor and fragrance industries to impart a sweet, spicy clove scent and flavor. Additionally, this compound has potential applications in cosmetics and pharmaceuticals due to its antioxidant and antimicrobial properties, providing benefits such as skin protection and preservation.
Catalog Number | M086341 |
CAS Number | 18604-50-7 |
Molecular Formula | C16H22O7 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-methoxy-4-prop-2-enylphenoxy)oxane-3,4,5-triol |
InChI | InChI=1S/C16H22O7/c1-3-4-9-5-6-10(11(7-9)21-2)22-16-15(20)14(19)13(18)12(8-17)23-16/h3,5-7,12-20H,1,4,8H2,2H3/t12-,13-,14+,15-,16-/m1/s1 |
InChIKey | VADSVXSGIFBZLI-IBEHDNSVSA-N |
SMILES | COC1=C(C=CC(=C1)CC=C)OC2C(C(C(C(O2)CO)O)O)O |