For research use only. Not for therapeutic Use.
EUK-189 (Cat.No:M137579) is a synthetic antioxidant compound known for its potential in reducing oxidative stress. It belongs to the class of metal-containing antioxidants and mimics the activity of superoxide dismutase and catalase. EUK-189 has shown promise in preclinical studies for its cytoprotective effects, making it a subject of interest in various medical and scientific research fields.
| Catalog Number | M137579 |
| CAS Number | 186350-27-6 |
| Molecular Formula | C20H25ClMnN2O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (6E)-2-ethoxy-6-[[2-[[(E)-(5-ethoxy-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;manganese;hydrochloride |
| InChI | InChI=1S/C20H24N2O4.ClH.Mn/c1-3-25-17-9-5-7-15(19(17)23)13-21-11-12-22-14-16-8-6-10-18(20(16)24)26-4-2;;/h5-10,13-14,21-22H,3-4,11-12H2,1-2H3;1H;/b15-13+,16-14+;; |
| InChIKey | RWGARCBCLBLXJA-YTILDLQKSA-N |
| SMILES | CCOC1=CC=CC(=CNCCNC=C2C=CC=C(C2=O)OCC)C1=O.Cl.[Mn] |
