For research use only. Not for therapeutic Use.
Eurycomanone（Cat No.:R039782）is a bioactive quassinoid compound extracted from the roots of Eurycoma longifolia, commonly known as Tongkat Ali. It is renowned for its medicinal properties, including enhancing male fertility, boosting testosterone levels, and improving libido. Additionally, eurycomanone exhibits anti-malarial, anti-cancer, and anti-inflammatory activities, making it a versatile compound in traditional and modern medicine. Its ability to modulate various biological pathways contributes to overall well-being and vitality. Due to these health benefits, eurycomanone is a popular ingredient in dietary supplements aimed at improving physical performance and health.
| Catalog Number | R039782 |
| CAS Number | 84633-29-4 |
| Synonyms | (1R,4R,5R,7R,8R,11R,13S,17S,18S,19R)-4,5,7,8,17-pentahydroxy-14,18-dimethyl-6-methylidene-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-ene-9,16-dione |
| Molecular Formula | C20H24O9 |
| Purity | ≥95% |
| IUPAC Name | (1R,4R,5R,7R,8R,11R,13S,17S,18S,19R)-4,5,7,8,17-pentahydroxy-14,18-dimethyl-6-methylidene-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-ene-9,16-dione |
| InChI | InChI=1S/C20H24O9/c1-7-4-10(21)13(23)17(3)9(7)5-11-18-6-28-20(27,16(17)18)12(22)8(2)19(18,26)14(24)15(25)29-11/h4,9,11-14,16,22-24,26-27H,2,5-6H2,1,3H3/t9-,11+,12+,13+,14-,16+,17+,18+,19-,20-/m0/s1 |
| InChIKey | UCUWZJWAQQRCOR-OKNZMGBLSA-N |
| SMILES | CC1=CC(=O)C(C2(C1CC3C45C2C(C(C(=C)C4(C(C(=O)O3)O)O)O)(OC5)O)C)O |
