For research use only. Not for therapeutic Use.
Evenamide（Cat No.:I006739） is a compound that acts as a modulator of sodium and/or calcium channels. It shows potential in preventing, alleviating, and possibly curing various pathologies, including neurological, cognitive, psychiatric, inflammatory, urogenital, and gastrointestinal diseases. By influencing the activity of these channels, even amid aims to restore normal neuronal signaling and cellular function, thereby offering therapeutic benefits across multiple disease areas.
| Catalog Number | I006739 |
| CAS Number | 1092977-61-1 |
| Synonyms | NW-3509; NW 3509; NW3509; NW-3509A; Evenamide;2-((3-butoxyphenethyl)amino)-N,N-dimethylacetamide |
| Molecular Formula | C16H26N2O2 |
| Purity | ≥95% |
| Target | Sodium Channel |
| Solubility | Soluble in DMSO, not in water |
| Storage | Store at -20°C |
| IUPAC Name | 2-[2-(3-butoxyphenyl)ethylamino]-N,N-dimethylacetamide |
| InChI | InChI=1S/C16H26N2O2/c1-4-5-11-20-15-8-6-7-14(12-15)9-10-17-13-16(19)18(2)3/h6-8,12,17H,4-5,9-11,13H2,1-3H3 |
| InChIKey | GRHBODILPPXVKN-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)CCNCC(=O)N(C)C |
