For research use only. Not for therapeutic Use.
Evernic Acid(Cat No.:I011809)is a naturally occurring depside primarily found in lichen species, such as Evernia prunastri. Known for its antimicrobial, antioxidant, and anti-inflammatory properties, evernic acid is widely researched for its potential in pharmacology and natural product chemistry. It has demonstrated activity against bacterial and fungal pathogens, making it a promising candidate for antimicrobial formulations. Additionally, evernic acid is being studied for its cytotoxic effects on cancer cells, which could offer applications in cancer treatment research. Its diverse bioactive properties make it valuable in developing natural health solutions.
Catalog Number | I011809 |
CAS Number | 537-09-7 |
Synonyms | 2-hydroxy-4-[(2-hydroxy-4-methoxy-6-methylbenzoyl)oxy]-6-methyl-benzoic acid |
Molecular Formula | C17H16O7 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 2-hydroxy-4-(2-hydroxy-4-methoxy-6-methylbenzoyl)oxy-6-methylbenzoic acid |
InChI | InChI=1S/C17H16O7/c1-8-5-11(7-12(18)14(8)16(20)21)24-17(22)15-9(2)4-10(23-3)6-13(15)19/h4-7,18-19H,1-3H3,(H,20,21) |
InChIKey | GODLCSLPZIBRMG-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1C(=O)OC2=CC(=C(C(=C2)C)C(=O)O)O)O)OC |