For research use only. Not for therapeutic Use.
Evocarpine（Cat No.:M074995）, is an alkaloid derived from Evodia rutaecarpa plant. It exhibits cardiovascular effects, including vasodilation and antiplatelet activity. This makes it a potential candidate for the treatment of hypertension and related cardiovascular conditions. However, further research is needed to fully understand its safety and effectiveness for medical use.
| Catalog Number | M074995 |
| CAS Number | 15266-38-3 |
| Molecular Formula | C23H33NO |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | 2-8°C |
| IUPAC Name | 1-methyl-2-[(Z)-tridec-8-enyl]quinolin-4-one |
| InChI | InChI=1S/C23H33NO/c1-3-4-5-6-7-8-9-10-11-12-13-16-20-19-23(25)21-17-14-15-18-22(21)24(20)2/h6-7,14-15,17-19H,3-5,8-13,16H2,1-2H3/b7-6- |
| InChIKey | HWFYWIVOYBPLQU-SREVYHEPSA-N |
| SMILES | CCCCC=CCCCCCCCC1=CC(=O)C2=CC=CC=C2N1C |
