For research use only. Not for therapeutic Use.
EWP 815(Cat No.:I042924)is a small molecule inhibitor that targets the receptor tyrosine kinase, EphA2, which plays a significant role in various cancers by promoting tumor growth, metastasis, and angiogenesis. By inhibiting EphA2, EWP 815 aims to block cancer cell signaling, thereby preventing tumor progression and spread. It has shown promise in preclinical studies for its potential in treating solid tumors, including lung, breast, and pancreatic cancers. EWP 815 is being investigated for its effectiveness in overcoming drug resistance and as an adjunct to conventional cancer therapies, offering a novel approach to cancer treatment.
CAS Number | 20231-01-0 |
Synonyms | (4-methylpiperazine-1-carbothioyl)sulfanyl 4-methylpiperazine-1-carbodithioate |
Molecular Formula | C12H22N4S4 |
Purity | ≥95% |
IUPAC Name | (4-methylpiperazine-1-carbothioyl)sulfanyl 4-methylpiperazine-1-carbodithioate |
InChI | InChI=1S/C12H22N4S4/c1-13-3-7-15(8-4-13)11(17)19-20-12(18)16-9-5-14(2)6-10-16/h3-10H2,1-2H3 |
InChIKey | OOBDBFPYJXJEHC-UHFFFAOYSA-N |
SMILES | CN1CCN(CC1)C(=S)SSC(=S)N2CCN(CC2)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |