For research use only. Not for therapeutic Use.
The EX-527 R-enantiomer (Cat.No:I005081) is a selective inhibitor of the enzyme sirtuin 1 (SIRT1). SIRT1 plays a crucial role in various biological processes, including metabolism, aging, and stress response. The EX-527 R-enantiomer is commonly used in research to study the functions and potential therapeutic applications of SIRT1 inhibition.
CAS Number | 848193-69-1 |
Synonyms | (R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
Molecular Formula | C13H13ClN2O |
Purity | ≥95% |
Target | Epigenetics |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | [1] |
IUPAC Name | (1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
InChI | InChI=1S/C13H13ClN2O/c14-7-4-5-11-10(6-7)8-2-1-3-9(13(15)17)12(8)16-11/h4-6,9,16H,1-3H2,(H2,15,17)/t9-/m1/s1 |
InChIKey | FUZYTVDVLBBXDL-SECBINFHSA-N |
SMILES | C1C[C@H](C2=C(C1)C3=C(N2)C=CC(=C3)Cl)C(=O)N |
Reference | <p style=/line-height:25px/> <br>[2]. Solomon JM, et al. Inhibition of SIRT1 catalytic activity increases p53 acetylation but does not alter cell survival following DNA damage. Mol Cell Biol. 2006 Jan;26(1):28-38. </p> |