For research use only. Not for therapeutic Use.
The EX-527 S-enantiomer (Cat.No:I005080) is a selective inhibitor of the enzyme Sirtuin 1 (SIRT1). SIRT1 plays a crucial role in cellular processes such as metabolism, aging, and stress response. By inhibiting SIRT1, the EX-527 S-enantiomer can modulate these processes and potentially have implications in various diseases. Further research is ongoing to explore its therapeutic potential.
Catalog Number | I005080 |
CAS Number | 848193-68-0 |
Synonyms | (S)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
Molecular Formula | C13H13ClN2O |
Purity | ≥95% |
Target | Epigenetics |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 123 nM [1] |
IUPAC Name | (1S)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
InChI | InChI=1S/C13H13ClN2O/c14-7-4-5-11-10(6-7)8-2-1-3-9(13(15)17)12(8)16-11/h4-6,9,16H,1-3H2,(H2,15,17)/t9-/m0/s1 |
InChIKey | FUZYTVDVLBBXDL-VIFPVBQESA-N |
SMILES | C1C[C@@H](C2=C(C1)C3=C(N2)C=CC(=C3)Cl)C(=O)N |
Reference | <p style=/line-height:25px/> <br>[2]. Solomon JM, et al. Inhibition of SIRT1 catalytic activity increases p53 acetylation but does not alter cell survival following DNA damage. Mol Cell Biol. 2006 Jan;26(1):28-38. </p> |