Exatecan Intermediate 1-d5（Cat No.:S001134） is a deuterated variant of a key precursor used in the synthesis of Exatecan, where five hydrogen atoms are replaced with deuterium. This isotopic labeling enhances the compound’s stability, facilitating more accurate pharmacokinetic and metabolic studies in the development of anticancer therapies. It is especially valuable in the pharmaceutical industry for optimizing synthesis pathways and improving the efficacy and safety of Exatecan, a potent topoisomerase inhibitor. Exatecan Intermediate 1-d5 serves as a crucial analytical tool in drug development, ensuring precise measurements and a better understanding of drug behavior.
| Catalog Number | S001134 |
| CAS Number | 1346617-23-9 |
| Molecular Formula | C13H8D5NO5 |
| Purity | ≥95% |
| IUPAC Name | (4S)-4-hydroxy-4-(1,1,2,2,2-pentadeuterioethyl)-7,8-dihydro-1H-pyrano[3,4-f]indolizine-3,6,10-trione |
| InChI | InChI=1S/C13H13NO5/c1-2-13(18)8-5-9-10(15)3-4-14(9)11(16)7(8)6-19-12(13)17/h5,18H,2-4,6H2,1H3/t13-/m0/s1/i1D3,2D2 |
| InChIKey | IGKWOGMVAOYVSJ-LZEHPYLUSA-N |
| SMILES | CCC1(C2=C(COC1=O)C(=O)N3CCC(=O)C3=C2)O |
