For research use only. Not for therapeutic Use.
Exo2（Cat No.:I043579）is an investigational small molecule compound being studied for its potential in treating cancer and other diseases by targeting the Exonuclease 2 (Exo2) enzyme. Exo2 is involved in DNA repair mechanisms, specifically in the process of excising nucleotides during DNA replication and repair. By inhibiting Exo2, the compound may enhance the sensitivity of cancer cells to DNA-damaging agents and improve the effectiveness of existing therapies, such as chemotherapy and radiation. Exo2 is being evaluated for its role in sensitizing tumors and potentially overcoming treatment resistance in various malignancies.
| CAS Number | 304684-77-3 |
| Synonyms | 2-methoxy-4-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]phenol |
| Molecular Formula | C18H18N4O2S |
| Purity | ≥95% |
| IUPAC Name | 2-methoxy-4-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]phenol |
| InChI | InChI=1S/C18H18N4O2S/c1-24-14-8-11(6-7-13(14)23)9-21-22-17-16-12-4-2-3-5-15(12)25-18(16)20-10-19-17/h6-10,23H,2-5H2,1H3,(H,19,20,22)/b21-9+ |
| InChIKey | VFNUTEMVQGLDAG-ZVBGSRNCSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=N/NC2=C3C4=C(CCCC4)SC3=NC=N2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
