For research use only. Not for therapeutic Use.
Ezatiostat (Cat No.:I002203) is a peptidomimetic inhibitor of Glutathione S-transferase P1-1 (GSTP1-1), which is an enzyme involved in the detoxification processes. It is a tripeptide analog of glutathione, a naturally occurring antioxidant. Ezatiostat activates c-Jun NH2 terminal kinase (JNK1) and ERK1/ERK2 signaling pathways, leading to the induction of apoptosis, or programmed cell death. This mechanism of action suggests its potential as an anticancer agent, particularly in malignancies where GSTP1-1 is overexpressed.
| Catalog Number | I002203 |
| CAS Number | 168682-53-9 |
| Synonyms | ethyl (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate |
| Molecular Formula | C₂₇H₃₅N₃O₆S |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | ethyl (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate |
| InChI | InChI=1S/C27H35N3O6S/c1-3-35-26(33)21(28)15-16-23(31)29-22(18-37-17-19-11-7-5-8-12-19)25(32)30-24(27(34)36-4-2)20-13-9-6-10-14-20/h5-14,21-22,24H,3-4,15-18,28H2,1-2H3,(H,29,31)(H,30,32)/t21-,22-,24+/m0/s1 |
| InChIKey | GWEJFLVSOGNLSS-WPFOTENUSA-N |
| SMILES | CCOC(=O)C(CCC(=O)NC(CSCC1=CC=CC=C1)C(=O)NC(C2=CC=CC=C2)C(=O)OCC)N |
| Reference | <p style=/line-height:25px/> |
