For research use only. Not for therapeutic Use.
Ezetimibe Ketone (Cat.No:R010049) is an intermediate compound in the synthesis of Ezetimibe, a medication used to lower cholesterol levels. It plays a crucial role in the transformation process that leads to the creation of Ezetimibe, which inhibits intestinal cholesterol absorption. Ezetimibe Ketone contributes to the development of this cholesterol-lowering pharmaceutical agent.
CAS Number | 191330-56-0 |
Synonyms | (3R,4S)-1-(4-Fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)-2-azetidinone; EZM-K; |
Molecular Formula | C24H19F2NO3 |
Purity | ≥95% |
Target | Autophagy |
Storage | Store at -20°C |
IUPAC Name | (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)azetidin-2-one |
InChI | InChI=1S/C24H19F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21,23,28H,13-14H2/t21-,23-/m1/s1 |
InChIKey | UEPZDXMEEKCJSP-FYYLOGMGSA-N |
SMILES | C1=CC(=CC=C1C2C(C(=O)N2C3=CC=C(C=C3)F)CCC(=O)C4=CC=C(C=C4)F)O |