For research use only. Not for therapeutic Use.
EZH2-IN-15(CAT: I040933) is a potent inhibitor of EZH2 (enhancer of zeste homolog 2), a key component of the polycomb repressive complex 2 (PRC2), which regulates gene expression through histone methylation. EZH2 is often overexpressed in various cancers, leading to silencing of tumor suppressor genes and promoting tumor progression. EZH2-IN-15 inhibits EZH2 activity, reversing aberrant gene silencing and suppressing cancer cell growth. It has shown potential in preclinical studies for targeting cancers, particularly hematological malignancies and solid tumors. This compound is highly relevant for Cancer Disease Research, offering a promising therapeutic strategy for tumors driven by dysregulated epigenetic mechanisms.
| CAS Number | 2098545-98-1 |
| Synonyms | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-ethyl-6-[ethyl(oxan-4-yl)amino]-2-(piperidin-1-ylmethyl)-1-benzofuran-4-carboxamide |
| Molecular Formula | C32H44N4O4 |
| Purity | ≥95% |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-ethyl-6-[ethyl(oxan-4-yl)amino]-2-(piperidin-1-ylmethyl)-1-benzofuran-4-carboxamide |
| InChI | InChI=1S/C32H44N4O4/c1-5-25-28(36(6-2)23-10-14-39-15-11-23)18-29-26(17-24(40-29)20-35-12-8-7-9-13-35)30(25)32(38)33-19-27-21(3)16-22(4)34-31(27)37/h16-18,23H,5-15,19-20H2,1-4H3,(H,33,38)(H,34,37) |
| InChIKey | YLZVNQZYAYVUCW-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(C=C1N(CC)C3CCOCC3)OC(=C2)CN4CCCCC4)C(=O)NCC5=C(C=C(NC5=O)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
