For research use only. Not for therapeutic Use.
EZM0414 TFA is a potent, selective and orally active inhibitor of SETD2 which is a human histone methyltransferase. EZM0414 TFA has anti-proliferative effects[1].
| Catalog Number | I044495 |
| CAS Number | 2411759-92-5 |
| Synonyms | N-[(1R,3S)-3-(4-acetylpiperazin-1-yl)cyclohexyl]-4-fluoro-7-methyl-1H-indole-2-carboxamide;2,2,2-trifluoroacetic acid |
| Molecular Formula | C24H30F4N4O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H29FN4O2.C2HF3O2/c1-14-6-7-19(23)18-13-20(25-21(14)18)22(29)24-16-4-3-5-17(12-16)27-10-8-26(9-11-27)15(2)28;3-2(4,5)1(6)7/h6-7,13,16-17,25H,3-5,8-12H2,1-2H3,(H,24,29);(H,6,7)/t16-,17+;/m1./s1 |
| InChIKey | HASNOYOGMISGTP-PPPUBMIESA-N |
| SMILES | CC1=C2C(=C(C=C1)F)C=C(N2)C(=O)NC3CCCC(C3)N4CCN(CC4)C(=O)C.C(=O)(C(F)(F)F)O |
| Reference | [1]. John Lampe, et al. Substituted indoles and methods of use thereof. WO2020037079A1. |
