For research use only. Not for therapeutic Use.
Ezurpimtrostat hydrochloride（Cat No.:I043460）is a novel investigational compound being studied for its potential in treating various metabolic disorders, including type 2 diabetes and obesity. It works by inhibiting specific enzymes involved in glucose metabolism, helping to regulate blood sugar levels. This compound has shown promising results in preclinical and early clinical trials, with a focus on improving insulin sensitivity and reducing weight gain. As a therapeutic agent, Ezurpimtrostat hydrochloride is being researched for its role in advancing metabolic health and providing a new option for managing chronic conditions associated with metabolic syndrome.
| CAS Number | 1914148-73-4 |
| Synonyms | 4-[4-(tert-butylamino)piperidin-1-yl]-N-[(4-chlorophenyl)methyl]quinolin-2-amine;hydrochloride |
| Molecular Formula | C25H32Cl2N4 |
| Purity | ≥95% |
| IUPAC Name | 4-[4-(tert-butylamino)piperidin-1-yl]-N-[(4-chlorophenyl)methyl]quinolin-2-amine;hydrochloride |
| InChI | InChI=1S/C25H31ClN4.ClH/c1-25(2,3)29-20-12-14-30(15-13-20)23-16-24(28-22-7-5-4-6-21(22)23)27-17-18-8-10-19(26)11-9-18;/h4-11,16,20,29H,12-15,17H2,1-3H3,(H,27,28);1H |
| InChIKey | DLXMKLHCUTYCGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1CCN(CC1)C2=CC(=NC3=CC=CC=C32)NCC4=CC=C(C=C4)Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
