For research use only. Not for therapeutic Use.
F-1893(CAT: I027219) is a chemical compound with diverse applications. It may be used as a precursor in organic synthesis, a reagent in chemical reactions, or as a component in various formulations. The specific properties and uses of F-1893 can vary depending on its context within chemical processes or applications, making it a versatile compound with potential contributions to multiple fields.
| Catalog Number | I027219 |
| CAS Number | 3808-93-3 |
| Synonyms | F-1893; F1893; F 1893 |
| Molecular Formula | C13H9ClO2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (1,1'-Biphenyl)-4-carboxylic acid, 2'-chloro- |
| InChI | InChI=1S/C13H9ClO2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)13(15)16/h1-8H,(H,15,16) |
| InChIKey | AOTYKBXXCYCXRZ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(cc1)c2ccccc2Cl |
